PROPANE(DITHIOIC)ACID

pro_cas
1892-30-4
pro_cdbregno
CCD05637387
pro_formula
C3 H6 S2
pro_molWeight
106.212

basic_info

Product_Name: PROPANE(DITHIOIC)ACID
CAS: 1892-30-4
EnglishSynonyms: PROPANE(DITHIOIC)ACID
pro_mdlNumber: MFCD20488789
pro_acceptors: 0
pro_donors: 0
pro_smile: CCC(=S)S
InChi: InChI=1S/C3H6S2/c1-2-3(4)5/h2H2,1H3,(H,4,5)
InChiKey: InChIKey=MVCPDOUDYOUTKS-UHFFFAOYSA-N