3,5,7-TRIOXOOCTANOIC ACID

pro_cas
pro_cdbregno
CCD05752833
pro_formula
C8 H10 O5
pro_molWeight
186.162

basic_info

Product_Name: 3,5,7-TRIOXOOCTANOIC ACID
EnglishSynonyms: 3,5,7-TRIOXOOCTANOIC ACID
pro_mdlNumber: MFCD20641095
pro_acceptors: 5
pro_donors: 1
pro_smile: CC(=O)CC(=O)CC(=O)CC(=O)O
InChi: InChI=1S/C8H10O5/c1-5(9)2-6(10)3-7(11)4-8(12)13/h2-4H2,1H3,(H,12,13)
InChiKey: InChIKey=PZBQJHYTCAQGMA-UHFFFAOYSA-N

* If the product has intellectual property rights, a license granted is must or contact us.