PROPYL 5-AMINO-3-OXO-2,3-DIHYDRO-1H-PYRAZOLE-4-CARBOXYLATE

pro_cas
pro_cdbregno
CCD05808377
pro_formula
C7 H11 N3 O3
pro_molWeight
185.182

basic_info

Product_Name: PROPYL 5-AMINO-3-OXO-2,3-DIHYDRO-1H-PYRAZOLE-4-CARBOXYLATE
EnglishSynonyms: PROPYL 5-AMINO-3-OXO-2,3-DIHYDRO-1H-PYRAZOLE-4-CARBOXYLATE
pro_mdlNumber: MFCD20698100
pro_acceptors: 6
pro_donors: 3
pro_smile: CCCOC(=O)c1c([nH][nH]c1=O)N
InChi: InChI=1S/C7H11N3O3/c1-2-3-13-7(12)4-5(8)9-10-6(4)11/h2-3H2,1H3,(H4,8,9,10,11)
InChiKey: InChIKey=BWAUSQXFHSUYET-UHFFFAOYSA-N

* If the product has intellectual property rights, a license granted is must or contact us.