2-CYANO-2-FLUORO-1,2-DIHYDROPYRIDINE-4-CARBOXYLIC ACID

pro_cas
3939-14-8
pro_cdbregno
CCD06163468
pro_formula
C7 H5 F N2 O2
pro_molWeight
168.126

basic_info

Product_Name: 2-CYANO-2-FLUORO-1,2-DIHYDROPYRIDINE-4-CARBOXYLIC ACID
CAS: 3939-14-8
EnglishSynonyms: 2-CYANO-2-FLUORO-1,2-DIHYDROPYRIDINE-4-CARBOXYLIC ACID ; 4-CYANO-2-FLUORO PYRIDINE
pro_mdlNumber: MFCD21090343
pro_acceptors: 4
pro_donors: 2
pro_smile: C1=CNC(C=C1C(=O)O)(C#N)F
InChi: InChI=1S/C7H5FN2O2/c8-7(4-9)3-5(6(11)12)1-2-10-7/h1-3,10H,(H,11,12)
InChiKey: InChIKey=IOUXGEGONLZJOJ-UHFFFAOYSA-N