5-(2,3-DIHYDRO-1,4-BENZODIOXIN-6-YL)-4,5-DIHYDRO-1H-IMIDAZOL-2-AMINE

pro_cas
pro_cdbregno
CCD06970765
pro_formula
C11 H13 N3 O2
pro_molWeight
219.243

basic_info

Product_Name: 5-(2,3-DIHYDRO-1,4-BENZODIOXIN-6-YL)-4,5-DIHYDRO-1H-IMIDAZOL-2-AMINE
EnglishSynonyms: 5-(2,3-DIHYDRO-1,4-BENZODIOXIN-6-YL)-4,5-DIHYDRO-1H-IMIDAZOL-2-AMINE
pro_mdlNumber: MFCD21941702
pro_acceptors: 5
pro_donors: 2
pro_smile: c1cc2c(cc1C3CN=C(N3)N)OCCO2
InChi: InChI=1S/C11H13N3O2/c12-11-13-6-8(14-11)7-1-2-9-10(5-7)16-4-3-15-9/h1-2,5,8H,3-4,6H2,(H3,12,13,14)
InChiKey: InChIKey=QKVSBBWERRTALQ-UHFFFAOYSA-N

* If the product has intellectual property rights, a license granted is must or contact us.