
C23 H21 N5 O3


Product_Name: GSK1210151A
CAS: 1300031-49-5
pro_mdlNumber: MFCD22124472
pro_acceptors: 8
pro_donors: 1
pro_smile: Cc1c(c(on1)C)c2cc3c(cc2OC)c4c(cn3)[nH]c(=O)n4[C@H](C)c5ccccn5
InChi: InChI=1S/C23H21N5O3/c1-12-21(14(3)31-27-12)16-9-18-15(10-20(16)30-4)22-19(11-25-18)26-23(29)28(22)13(2)17-7-5-6-8-24-17/h5-11,13H,1-4H3,(H,26,29)/t13-/m1/s1

