2-(N-ISOPROPYL-N-METHYLAMINO)-N-(2-AMINOETHYL)ACETAMIDE DIHYDROCHLORIDE

pro_cas
1337881-96-5
pro_cdbregno
CCD07368625
pro_formula
C8 H19 N3 O . 2 Cl H
pro_molWeight
246.18

basic_info

Product_Name: 2-(N-ISOPROPYL-N-METHYLAMINO)-N-(2-AMINOETHYL)ACETAMIDE DIHYDROCHLORIDE
CAS: 1337881-96-5
EnglishSynonyms: 2-(N-ISOPROPYL-N-METHYLAMINO)-N-(2-AMINOETHYL)ACETAMIDE DIHYDROCHLORIDE
pro_mdlNumber: MFCD22380369
pro_acceptors: 4
pro_donors: 2
pro_smile: CC(C)N(C)CC(=O)NCCN.Cl.Cl
InChi: InChI=1S/C8H19N3O.2ClH/c1-7(2)11(3)6-8(12)10-5-4-9;;/h7H,4-6,9H2,1-3H3,(H,10,12);2*1H
InChiKey: InChIKey=YRVUXSJCGFYHJJ-UHFFFAOYSA-N