NEOPENTYL TRIFLUOROMETHANESULFONATE

pro_cas
pro_cdbregno
CCD07371217
pro_formula
C6 H11 F3 O3 S
pro_molWeight
220.21

basic_info

Product_Name: NEOPENTYL TRIFLUOROMETHANESULFONATE
EnglishSynonyms: NEOPENTYL TRIFLUOROMETHANESULFONATE
pro_mdlNumber: MFCD22384942
pro_acceptors: 3
pro_donors: 0
pro_smile: CC(C)(C)COS(=O)(=O)C(F)(F)F
InChi: InChI=1S/C6H11F3O3S/c1-5(2,3)4-12-13(10,11)6(7,8)9/h4H2,1-3H3
InChiKey: InChIKey=DAYGMTZDTVBMPO-UHFFFAOYSA-N

* If the product has intellectual property rights, a license granted is must or contact us.