1-(9H-XANTHEN-9-YL)ETHAN-1-OL

pro_cas
pro_cdbregno
CCD07701682
pro_formula
C15 H14 O2
pro_molWeight
226.274

basic_info

Product_Name: 1-(9H-XANTHEN-9-YL)ETHAN-1-OL
EnglishSynonyms: 1-(9H-XANTHEN-9-YL)ETHAN-1-OL
pro_mdlNumber: MFCD22821704
pro_acceptors: 2
pro_donors: 1
pro_smile: CC(C1c2ccccc2Oc3c1cccc3)O
InChi: InChI=1S/C15H14O2/c1-10(16)15-11-6-2-4-8-13(11)17-14-9-5-3-7-12(14)15/h2-10,15-16H,1H3
InChiKey: InChIKey=LRSXHBOUBXHHPT-UHFFFAOYSA-N