4-oxotridecanoic acid

pro_cas
92155-71-0
pro_cdbregno
CCD08298770
pro_formula
C13H24O3
pro_molWeight
228.3279

basic_info

Product_Name: 4-oxotridecanoic acid
CAS: 92155-71-0
EnglishSynonyms: 4-OXOTRIDECANOIC ACID
pro_acceptors: 0
pro_donors: 0
pro_smile: O=C(CCC(=O)O)CCCCCCCCC
InChi: InChI=1S/C13H24O3/c1-2-3-4-5-6-7-8-9-12(14)10-11-13(15)16/h2-11H2,1H3,(H,15,16)
InChiKey: InChIKey=MFVKNKJZCSBJML-UHFFFAOYSA-N

property

secure_info