1-Isopropoxy-2-isothiocyanato-4-methanesulfonyl-benzene

pro_cas
1377582-35-8
pro_cdbregno
CCD08299619
pro_formula
C11H13NO3S2
pro_molWeight
271.356

basic_info

Product_Name: 1-Isopropoxy-2-isothiocyanato-4-methanesulfonyl-benzene
CAS: 1377582-35-8
EnglishSynonyms: 1-ISOPROPOXY-2-ISOTHIOCYANATO-4-METHANESULFONYL-BENZENE
pro_acceptors: 0
pro_donors: 0
pro_smile: C(C)(C)OC1=C(C=C(C=C1)S(=O)(=O)C)N=C=S
InChi: InChI=1S/C11H13NO3S2/c1-8(2)15-11-5-4-9(17(3,13)14)6-10(11)12-7-16/h4-6,8H,1-3H3
InChiKey: InChIKey=QDVJWZZUKRYYGY-UHFFFAOYSA-N

property

secure_info