3-chloro-4-methoxyphenyl isothiocyanate

pro_cas
23165-42-6
pro_cdbregno
CCD08299634
pro_formula
C8H6ClNOS
pro_molWeight
199.657

basic_info

Product_Name: 3-chloro-4-methoxyphenyl isothiocyanate
CAS: 23165-42-6
EnglishSynonyms: 3-CHLORO-4-METHOXYPHENYL ISOTHIOCYANATE
pro_acceptors: 0
pro_donors: 0
pro_smile: ClC=1C=C(C=CC1OC)N=C=S
InChi: InChI=1S/C8H6ClNOS/c1-11-8-3-2-6(10-5-12)4-7(8)9/h2-4H,1H3
InChiKey: InChIKey=VEUNXTRDWRHQGO-UHFFFAOYSA-N

property

secure_info