(E)-3-(2-isothiocyanatophenyl)-2-propenal

pro_cas
19908-01-1
pro_cdbregno
CCD08299635
pro_formula
C10H7NOS
pro_molWeight
189.234

basic_info

Product_Name: (E)-3-(2-isothiocyanatophenyl)-2-propenal
CAS: 19908-01-1
EnglishSynonyms: (E)-3-(2-ISOTHIOCYANATOPHENYL)-2-PROPENAL
pro_acceptors: 0
pro_donors: 0
pro_smile: N(=C=S)C1=C(C=CC=C1)/C=C/C=O
InChi: InChI=1S/C10H7NOS/c12-7-3-5-9-4-1-2-6-10(9)11-8-13/h1-7H/b5-3+
InChiKey: InChIKey=MTXADZKTMUQBPZ-HWKANZROSA-N

property

secure_info