3-(9-fluoro-2,3,3a,4-tetrahydro-1H-5-oxa-9b-aza-cyclopenta[a]naphthalen-7-yl)-5-isothiocyanatomethyl-oxazolidin-2-one

pro_cas
463361-84-4
pro_cdbregno
CCD08299639
pro_formula
C16H16FN3O3S
pro_molWeight
349.38

basic_info

Product_Name: 3-(9-fluoro-2,3,3a,4-tetrahydro-1H-5-oxa-9b-aza-cyclopenta[a]naphthalen-7-yl)-5-isothiocyanatomethyl-oxazolidin-2-one
CAS: 463361-84-4
EnglishSynonyms: 3-(9-FLUORO-2,3,3A,4-TETRAHYDRO-1H-5-OXA-9B-AZA-CYCLOPENTA[A]NAPHTHALEN-7-YL)-5-ISOTHIOCYANATOMETHYL-OXAZOLIDIN-2-ONE
pro_acceptors: 0
pro_donors: 0
pro_smile: FC=1C=C(C=C2OCC3N(C12)CCC3)N3C(OC(C3)CN=C=S)=O
InChi: InChI=1S/C16H16FN3O3S/c17-13-4-11(20-7-12(6-18-9-24)23-16(20)21)5-14-15(13)19-3-1-2-10(19)8-22-14/h4-5,10,12H,1-3,6-8H2
InChiKey: InChIKey=PKLRURSVRADUDC-UHFFFAOYSA-N

property

secure_info