dimethyl 4-isothiocyanatoisophthalate

pro_cas
342803-20-7
pro_cdbregno
CCD08299648
pro_formula
C11H9NO4S
pro_molWeight
251.258

basic_info

Product_Name: dimethyl 4-isothiocyanatoisophthalate
CAS: 342803-20-7
EnglishSynonyms: DIMETHYL 4-ISOTHIOCYANATOISOPHTHALATE
pro_acceptors: 0
pro_donors: 0
pro_smile: N(=C=S)C1=C(C=C(C(=O)OC)C=C1)C(=O)OC
InChi: InChI=1S/C11H9NO4S/c1-15-10(13)7-3-4-9(12-6-17)8(5-7)11(14)16-2/h3-5H,1-2H3
InChiKey: InChIKey=YCBXSRZDFIUJSG-UHFFFAOYSA-N

property

secure_info