octyl chlorothioformate

pro_cas
86188-15-0
pro_cdbregno
CCD08299651
pro_formula
C9H17ClOS
pro_molWeight
208.749

basic_info

Product_Name: octyl chlorothioformate
CAS: 86188-15-0
EnglishSynonyms: OCTYL CHLOROTHIOFORMATE
pro_acceptors: 0
pro_donors: 0
pro_smile: ClC(=S)OCCCCCCCC
InChi: InChI=1S/C9H17ClOS/c1-2-3-4-5-6-7-8-11-9(10)12/h2-8H2,1H3
InChiKey: InChIKey=NXHLRFBGXAWZHI-UHFFFAOYSA-N

property

secure_info