{5-[2-(2,6-dichloro-phenyl)-3H-benzoimidazol-5-yl]-[1,3,4]oxadiazol-2-yl}-(5-fluoro-pyridin-2-yl)-amine

pro_cas
1137671-00-1
pro_cdbregno
CCD08299656
pro_formula
C20H11Cl2FN6O
pro_molWeight
441.245

basic_info

Product_Name: {5-[2-(2,6-dichloro-phenyl)-3H-benzoimidazol-5-yl]-[1,3,4]oxadiazol-2-yl}-(5-fluoro-pyridin-2-yl)-amine
CAS: 1137671-00-1
EnglishSynonyms: {5-[2-(2,6-DICHLORO-PHENYL)-3H-BENZOIMIDAZOL-5-YL]-[1,3,4]OXADIAZOL-2-YL}-(5-FLUORO-PYRIDIN-2-YL)-AMINE
pro_acceptors: 0
pro_donors: 0
pro_smile: ClC1=C(C(=CC=C1)Cl)C=1NC2=C(N1)C=CC(=C2)C2=NN=C(O2)NC2=NC=C(C=C2)F
InChi: InChI=1S/C20H11Cl2FN6O/c21-12-2-1-3-13(22)17(12)18-25-14-6-4-10(8-15(14)26-18)19-28-29-20(30-19)27-16-7-5-11(23)9-24-16/h1-9H,(H,25,26)(H,24,27,29)
InChiKey: InChIKey=WCSULUTYHBHUGP-UHFFFAOYSA-N

property

secure_info