(R)-tert-Butyl 2-amino-3-hydroxypropylcarbamate

pro_cas
1389385-19-6
pro_cdbregno
CCD08301890
pro_formula
C8H18N2O3
pro_molWeight
190.2401

basic_info

Product_Name: (R)-tert-Butyl 2-amino-3-hydroxypropylcarbamate
CAS: 1389385-19-6
EnglishSynonyms: (R)-TERT-BUTYL 2-AMINO-3-HYDROXYPROPYLCARBAMATE
pro_acceptors: 0
pro_donors: 0
pro_smile: N[C@H](CNC(OC(C)(C)C)=O)CO
InChi: InChI=1S/C8H18N2O3/c1-8(2,3)13-7(12)10-4-6(9)5-11/h6,11H,4-5,9H2,1-3H3,(H,10,12)/t6-/m1/s1
InChiKey: InChIKey=PCTCLLZTTRWASL-ZCFIWIBFSA-N

property

secure_info

* If the product has intellectual property rights, a license granted is mus