1H-Isoindole-1,3(2H)-dione, 4-bromo-2-(2,6-dioxo-3-piperidinyl)-

pro_cas
2093536-12-8
pro_cdbregno
CCD08301945
pro_formula
C13H9BrN2O4
pro_molWeight
337.126

basic_info

Product_Name: 1H-Isoindole-1,3(2H)-dione, 4-bromo-2-(2,6-dioxo-3-piperidinyl)-
CAS: 2093536-12-8
EnglishSynonyms: 1H-ISOINDOLE-1,3(2H)-DIONE, 4-BROMO-2-(2,6-DIOXO-3-PIPERIDINYL)-
pro_acceptors: 0
pro_donors: 0
pro_smile: BrC1=C2C(N(C(C2=CC=C1)=O)C1C(NC(CC1)=O)=O)=O
InChi: InChI=1S/C13H9BrN2O4/c14-7-3-1-2-6-10(7)13(20)16(12(6)19)8-4-5-9(17)15-11(8)18/h1-3,8H,4-5H2,(H,15,17,18)
InChiKey: InChIKey=NUICQRZENMKDBW-UHFFFAOYSA-N

property

secure_info

* If the product has intellectual property rights, a license granted is must or contact us.