4-[[6-[1,4-Dihydro-6-(2-pyridinyl)-1,2,4,5-tetrazin-3-yl]-3-pyridinyl]amino]-4-oxobutanoic acid

pro_cas
1907651-34-6
pro_cdbregno
CCD08302687
pro_formula
C16H15N7O3
pro_molWeight
353.3354

basic_info

Product_Name: 4-[[6-[1,4-Dihydro-6-(2-pyridinyl)-1,2,4,5-tetrazin-3-yl]-3-pyridinyl]amino]-4-oxobutanoic acid
CAS: 1907651-34-6
EnglishSynonyms: 4-[[6-[1,4-DIHYDRO-6-(2-PYRIDINYL)-1,2,4,5-TETRAZIN-3-YL]-3-PYRIDINYL]AMINO]-4-OXOBUTANOIC ACID
pro_acceptors: 0
pro_donors: 0
pro_smile: N1=C(C=CC=C1)C1=NNC(=NN1)C1=CC=C(C=N1)NC(CCC(=O)O)=O
InChi: InChI=1S/C16H15N7O3/c24-13(6-7-14(25)26)19-10-4-5-12(18-9-10)16-22-20-15(21-23-16)11-3-1-2-8-17-11/h1-5,8-9H,6-7H2,(H,19,24)(H,20,21)(H,22,23)(H,25,26)
InChiKey: InChIKey=SCKXQJSCEBJSQA-UHFFFAOYSA-N

property

secure_info

* If the product has intellectual property rights, a license granted is must or contact us.