* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | 5-(4-ETHYNYLPHENYL)-1,3-OXAZOLE |
| CAS: | 501944-63-4 |
| EnglishSynonyms: | 5-(4-ETHYNYLPHENYL)-1,3-OXAZOLE ; 4-(1,3-OXAZOL-5-YL)PHENYLACETYLENE |
| pro_mdlNumber: | MFCD08435847 |
| pro_acceptors: | 2 |
| pro_donors: | 0 |
| pro_smile: | C#Cc1ccc(cc1)c2cnco2 |
| InChi: | InChI=1S/C11H7NO/c1-2-9-3-5-10(6-4-9)11-7-12-8-13-11/h1,3-8H |
| InChiKey: | InChIKey=CYRYZDZQFDRTHD-UHFFFAOYSA-N |
|
|
| MeltingPoint: | 76-77 DEG C |
|
|
* If the product has intellectual property rights, a license granted is must or contact us.