* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | HDH-PHARMA 22587 |
| EnglishSynonyms: | HDH-PHARMA 22588 ; HDH-PHARMA 22589 ; HDH-PHARMA 22587 |
| pro_mdlNumber: | MFCD11872933 |
| pro_acceptors: | 4 |
| pro_donors: | 0 |
| pro_smile: | CC(C)(C)OC(=O)N1CCCC1COCC1=CC=C(SC(F)(F)F)C=C1 |
| InChi: | InChI=1S/C18H24F3NO3S/c1-17(2,3)25-16(23)22-10-4-5-14(22)12-24-11-13-6-8-15(9-7-13)26-18(19,20)21/h6-9,14H,4-5,10-12H2,1-3H3 |
| InChiKey: | InChIKey=VQELIPXMLIPRRT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.