* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | HDH-PHARMA 22971 |
| EnglishSynonyms: | HDH-PHARMA 22971 ; HDH-PHARMA 22972 ; HDH-PHARMA 22973 |
| pro_mdlNumber: | MFCD11873248 |
| pro_acceptors: | 5 |
| pro_donors: | 0 |
| pro_smile: | COC1=C(F)C=C(COCC2CCCN2C(=O)OC(C)(C)C)C=C1Cl |
| InChi: | InChI=1S/C18H25ClFNO4/c1-18(2,3)25-17(22)21-7-5-6-13(21)11-24-10-12-8-14(19)16(23-4)15(20)9-12/h8-9,13H,5-7,10-11H2,1-4H3 |
| InChiKey: | InChIKey=IZGIKEXVSZOOFS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.