* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | HDH-PHARMA 25683 |
| EnglishSynonyms: | HDH-PHARMA 25684 ; HDH-PHARMA 25683 ; HDH-PHARMA 25685 |
| pro_mdlNumber: | MFCD11875336 |
| pro_acceptors: | 4 |
| pro_donors: | 0 |
| pro_smile: | CC(C)(C)OC(=O)N1CCCC1COCC1=CC=CC(F)=C1C(F)(F)F |
| InChi: | InChI=1S/C18H23F4NO3/c1-17(2,3)26-16(24)23-9-5-7-13(23)11-25-10-12-6-4-8-14(19)15(12)18(20,21)22/h4,6,8,13H,5,7,9-11H2,1-3H3 |
| InChiKey: | InChIKey=FOXACTXPYPFWQJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.