* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product_Name: | RARECHEM AL BT 0474 |
EnglishSynonyms: | RARECHEM AL BT 0474 |
pro_mdlNumber: | MFCD06212129 |
pro_acceptors: | 5 |
pro_donors: | 2 |
pro_smile: | c1cc(c(cc1[N+](=O)[O-])C(CCO)N)SC2CCCCC2.Cl |
InChi: | InChI=1S/C15H22N2O3S.ClH/c16-14(8-9-18)13-10-11(17(19)20)6-7-15(13)21-12-4-2-1-3-5-12;/h6-7,10,12,14,18H,1-5,8-9,16H2;1H |
InChiKey: | InChIKey=NYAYYPMACJAXFF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.