* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | HDH-PHARMA 23091 |
| EnglishSynonyms: | HDH-PHARMA 23093 ; HDH-PHARMA 23092 ; HDH-PHARMA 23091 |
| pro_mdlNumber: | MFCD11873348 |
| pro_acceptors: | 4 |
| pro_donors: | 0 |
| pro_smile: | CC1=C(F)C(COCC2CCCN2C(=O)OC(C)(C)C)=C(Cl)C=C1 |
| InChi: | InChI=1S/C18H25ClFNO3/c1-12-7-8-15(19)14(16(12)20)11-23-10-13-6-5-9-21(13)17(22)24-18(2,3)4/h7-8,13H,5-6,9-11H2,1-4H3 |
| InChiKey: | InChIKey=JQDSYDNLMMELSF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.