* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | HDH-PHARMA 23739 |
| EnglishSynonyms: | HDH-PHARMA 23741 ; HDH-PHARMA 23739 ; HDH-PHARMA 23740 |
| pro_mdlNumber: | MFCD11873880 |
| pro_acceptors: | 4 |
| pro_donors: | 0 |
| pro_smile: | CC(C)(C)OC(=O)N1CCCC1COCC1=C(C=CC=C1F)C(F)(F)F |
| InChi: | InChI=1S/C18H23F4NO3/c1-17(2,3)26-16(24)23-9-5-6-12(23)10-25-11-13-14(18(20,21)22)7-4-8-15(13)19/h4,7-8,12H,5-6,9-11H2,1-3H3 |
| InChiKey: | InChIKey=HPOWQASWWWLTPT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.