* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product_Name: | WUXIAPPTEC WX105151-001 |
EnglishSynonyms: | WUXIAPPTEC WX105151-005 ; WUXIAPPTEC WX105151-010 ; WUXIAPPTEC WX105151-001 |
pro_mdlNumber: | MFCD15530223 |
pro_acceptors: | 4 |
pro_donors: | 1 |
pro_smile: | BrC1=CC=C2NS(=O)(=O)C3(CCOCC3)C2=C1 |
InChi: | InChI=1S/C11H12BrNO3S/c12-8-1-2-10-9(7-8)11(17(14,15)13-10)3-5-16-6-4-11/h1-2,7,13H,3-6H2 |
InChiKey: | InChIKey=JGVLVTAQIOSVIG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.