* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | WUXIAPPTEC WX105159-001 |
| EnglishSynonyms: | WUXIAPPTEC WX105159-005 ; WUXIAPPTEC WX105159-001 ; WUXIAPPTEC WX105159-010 |
| pro_mdlNumber: | MFCD17016293 |
| pro_acceptors: | 4 |
| pro_donors: | 1 |
| pro_smile: | CC(C)(C)OC(=O)N1CCC2(CC1)CCC(F)(F)[C@H]1CNC[C@@H]21 |
| InChi: | InChI=1S/C17H28F2N2O2/c1-15(2,3)23-14(22)21-8-6-16(7-9-21)4-5-17(18,19)13-11-20-10-12(13)16/h12-13,20H,4-11H2,1-3H3/t12-,13+/m1/s1 |
| InChiKey: | InChIKey=DAUYFZGMECCZBC-OLZOCXBDSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.