* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product_Name: | WUXIAPPTEC WX105191-001 |
EnglishSynonyms: | WUXIAPPTEC WX105191-001 ; WUXIAPPTEC WX105191-005 ; WUXIAPPTEC WX105191-010 |
pro_mdlNumber: | MFCD17016321 |
pro_acceptors: | 4 |
pro_donors: | 1 |
pro_smile: | CC(C)(C)OC(=O)N1CCCC2(CCNC2)C2=CC=CC=C12 |
InChi: | InChI=1S/C18H26N2O2/c1-17(2,3)22-16(21)20-12-6-9-18(10-11-19-13-18)14-7-4-5-8-15(14)20/h4-5,7-8,19H,6,9-13H2,1-3H3 |
InChiKey: | InChIKey=VZBKRYHHMUAZTP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.