* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | WUXIAPPTEC WX105209-001 |
| EnglishSynonyms: | WUXIAPPTEC WX105209-001 ; WUXIAPPTEC WX105209-010 ; WUXIAPPTEC WX105209-005 |
| pro_mdlNumber: | MFCD17016337 |
| pro_acceptors: | 6 |
| pro_donors: | 0 |
| pro_smile: | CSC1=NC2=C(COCC22CCN(CC2)C(=O)OCC2=CC=CC=C2)C=N1 |
| InChi: | InChI=1S/C20H23N3O3S/c1-27-18-21-11-16-13-25-14-20(17(16)22-18)7-9-23(10-8-20)19(24)26-12-15-5-3-2-4-6-15/h2-6,11H,7-10,12-14H2,1H3 |
| InChiKey: | InChIKey=NVJDLLSLUADPHB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.