* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | WUXIAPPTEC WX105222-001 |
| EnglishSynonyms: | WUXIAPPTEC WX105222-010 ; WUXIAPPTEC WX105222-001 ; WUXIAPPTEC WX105222-005 |
| pro_mdlNumber: | MFCD17016345 |
| pro_acceptors: | 6 |
| pro_donors: | 1 |
| pro_smile: | O=C(OCC1=CC=CC=C1)N1CCC2(C1)COCC1=C2N=CN1 |
| InChi: | InChI=1S/C17H19N3O3/c21-16(23-8-13-4-2-1-3-5-13)20-7-6-17(10-20)11-22-9-14-15(17)19-12-18-14/h1-5,12H,6-11H2,(H,18,19) |
| InChiKey: | InChIKey=PDIMZTZXOZFISP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.