* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product_Name: | WUXIAPPTEC WX105228-001 |
EnglishSynonyms: | WUXIAPPTEC WX105228-005 ; WUXIAPPTEC WX105228-010 ; WUXIAPPTEC WX105228-001 |
pro_mdlNumber: | MFCD17016348 |
pro_acceptors: | 6 |
pro_donors: | 1 |
pro_smile: | O=C(OCC1=CC=CC=C1)N1CCC2(C1)OCC1=C2N=CN1 |
InChi: | InChI=1S/C16H17N3O3/c20-15(21-8-12-4-2-1-3-5-12)19-7-6-16(10-19)14-13(9-22-16)17-11-18-14/h1-5,11H,6-10H2,(H,17,18) |
InChiKey: | InChIKey=GSLQDWCLPBOFGK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.