* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product_Name: | WUXIAPPTEC WX105231-001 |
EnglishSynonyms: | WUXIAPPTEC WX105231-010 ; WUXIAPPTEC WX105231-005 ; WUXIAPPTEC WX105231-001 |
pro_mdlNumber: | MFCD17016351 |
pro_acceptors: | 8 |
pro_donors: | 1 |
pro_smile: | CC(C)(C)OC(=O)N1CC2=C(N=CN2)C2(CCN(C2)C(=O)OCC2=CC=CC=C2)C1 |
InChi: | InChI=1S/C22H28N4O4/c1-21(2,3)30-20(28)26-11-17-18(24-15-23-17)22(14-26)9-10-25(13-22)19(27)29-12-16-7-5-4-6-8-16/h4-8,15H,9-14H2,1-3H3,(H,23,24) |
InChiKey: | InChIKey=LXGMSHVCVHOYBO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.