* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | WUXIAPPTEC WX105285-001 |
| EnglishSynonyms: | WUXIAPPTEC WX105285-010 ; WUXIAPPTEC WX105285-005 ; WUXIAPPTEC WX105285-001 |
| pro_mdlNumber: | MFCD17016382 |
| pro_acceptors: | 9 |
| pro_donors: | 0 |
| pro_smile: | CC(C)(C)OC(=O)N1CCN(CC2(CCN3C(Br)=NN=C23)C1)C(=O)OCC1=CC=CC=C1 |
| InChi: | InChI=1S/C22H28BrN5O4/c1-21(2,3)32-20(30)27-12-11-26(19(29)31-13-16-7-5-4-6-8-16)14-22(15-27)9-10-28-17(22)24-25-18(28)23/h4-8H,9-15H2,1-3H3 |
| InChiKey: | InChIKey=NOZFJEMBQKLSQW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.