* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | WUXIAPPTEC WX105286-001 |
| EnglishSynonyms: | WUXIAPPTEC WX105286-001 ; WUXIAPPTEC WX105286-010 ; WUXIAPPTEC WX105286-005 |
| pro_mdlNumber: | MFCD17016383 |
| pro_acceptors: | 8 |
| pro_donors: | 0 |
| pro_smile: | CC(C)(C)OC(=O)N1CCN(CC2(CCCN3C(Br)=CN=C23)C1)C(=O)OCC1=CC=CC=C1 |
| InChi: | InChI=1S/C24H31BrN4O4/c1-23(2,3)33-22(31)28-13-12-27(21(30)32-15-18-8-5-4-6-9-18)16-24(17-28)10-7-11-29-19(25)14-26-20(24)29/h4-6,8-9,14H,7,10-13,15-17H2,1-3H3 |
| InChiKey: | InChIKey=QSVKSMYFAGKYJY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.