* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product_Name: | WUXIAPPTEC WX105288-001 |
EnglishSynonyms: | WUXIAPPTEC WX105288-001 ; WUXIAPPTEC WX105288-005 ; WUXIAPPTEC WX105288-010 |
pro_mdlNumber: | MFCD17016385 |
pro_acceptors: | 9 |
pro_donors: | 0 |
pro_smile: | CC(C)(C)OC(=O)N1CCN(CC2(CCC3=NN=C(Br)N23)C1)C(=O)OCC1=CC=CC=C1 |
InChi: | InChI=1S/C22H28BrN5O4/c1-21(2,3)32-20(30)27-12-11-26(19(29)31-13-16-7-5-4-6-8-16)14-22(15-27)10-9-17-24-25-18(23)28(17)22/h4-8H,9-15H2,1-3H3 |
InChiKey: | InChIKey=YTDRRQRPNZJIDH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.