* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | WUXIAPPTEC WX105296-001 |
| EnglishSynonyms: | WUXIAPPTEC WX105296-001 ; WUXIAPPTEC WX105296-010 ; WUXIAPPTEC WX105296-005 |
| pro_mdlNumber: | MFCD17016393 |
| pro_acceptors: | 6 |
| pro_donors: | 0 |
| pro_smile: | CC(C)(C)OC(=O)N1CCOC2(CCC3=NC=C(Br)N3C2)C1 |
| InChi: | InChI=1S/C15H22BrN3O3/c1-14(2,3)22-13(20)18-6-7-21-15(9-18)5-4-12-17-8-11(16)19(12)10-15/h8H,4-7,9-10H2,1-3H3 |
| InChiKey: | InChIKey=OPCOSVWXABTIGE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.