* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product_Name: | WUXIAPPTEC WX105298-001 |
EnglishSynonyms: | WUXIAPPTEC WX105298-010 ; WUXIAPPTEC WX105298-001 ; WUXIAPPTEC WX105298-005 |
pro_mdlNumber: | MFCD17016395 |
pro_acceptors: | 6 |
pro_donors: | 1 |
pro_smile: | CC(C)(C)OC(=O)N1CCC2(CC1)CNC1=C(C2)C=NC=N1 |
InChi: | InChI=1S/C16H24N4O2/c1-15(2,3)22-14(21)20-6-4-16(5-7-20)8-12-9-17-11-19-13(12)18-10-16/h9,11H,4-8,10H2,1-3H3,(H,17,18,19) |
InChiKey: | InChIKey=UQBZPMYPBFKNCQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.