* If the product has intellectual property rights, a license granted is must or contact us.
basic_info |
|
Product_Name: | WUXIAPPTEC WX110235-001 |
EnglishSynonyms: | WUXIAPPTEC WX110235-005 ; WUXIAPPTEC WX110235-010 ; WUXIAPPTEC WX110235-001 |
pro_mdlNumber: | MFCD17016488 |
pro_acceptors: | 8 |
pro_donors: | 1 |
pro_smile: | [H][C@@]12CN([C@@H](C(O)=O)[C@]1([H])N(CCC2)C(=O)OCC1=CC=CC=C1)C(=O)OC(C)(C)C |
InChi: | InChI=1S/C21H28N2O6/c1-21(2,3)29-20(27)23-12-15-10-7-11-22(16(15)17(23)18(24)25)19(26)28-13-14-8-5-4-6-9-14/h4-6,8-9,15-17H,7,10-13H2,1-3H3,(H,24,25)/t15-,16-,17-/m1/s1 |
InChiKey: | InChIKey=RCCAFBLTFGMUNW-BRWVUGGUSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.