* If the product has intellectual property rights, a license granted is must or contact us.
basic_info |
|
Product_Name: | WUXIAPPTEC WX110249-001 |
EnglishSynonyms: | WUXIAPPTEC WX110249-001 ; WUXIAPPTEC WX110249-010 ; WUXIAPPTEC WX110249-005 |
pro_mdlNumber: | MFCD17016501 |
pro_acceptors: | 4 |
pro_donors: | 1 |
pro_smile: | [H][C@@]12CN(C[C@@]1(CCC[C@@H]2N)C(F)(F)F)C(=O)OC(C)(C)C |
InChi: | InChI=1S/C14H23F3N2O2/c1-12(2,3)21-11(20)19-7-9-10(18)5-4-6-13(9,8-19)14(15,16)17/h9-10H,4-8,18H2,1-3H3/t9-,10-,13+/m0/s1 |
InChiKey: | InChIKey=CSQODTHXZXDGKY-OUJBWJOFSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.