* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | WUXIAPPTEC WX110292-001 |
| EnglishSynonyms: | WUXIAPPTEC WX110292-010 ; WUXIAPPTEC WX110292-005 ; WUXIAPPTEC WX110292-001 |
| pro_mdlNumber: | MFCD17016540 |
| pro_acceptors: | 5 |
| pro_donors: | 1 |
| pro_smile: | CCOC(=O)C1COCC2NCCOC12 |
| InChi: | InChI=1S/C10H17NO4/c1-2-14-10(12)7-5-13-6-8-9(7)15-4-3-11-8/h7-9,11H,2-6H2,1H3 |
| InChiKey: | InChIKey=ODMMQFGAPSWHJG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.