* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | WUXIAPPTEC WX110307-001 |
| EnglishSynonyms: | WUXIAPPTEC WX110307-010 ; WUXIAPPTEC WX110307-005 ; WUXIAPPTEC WX110307-001 |
| pro_mdlNumber: | MFCD17016555 |
| pro_acceptors: | 5 |
| pro_donors: | 2 |
| pro_smile: | CC(C)(C)OC(=O)N1CC[C@@H]2NCCCN[C@@H]2C1 |
| InChi: | InChI=1S/C13H25N3O2/c1-13(2,3)18-12(17)16-8-5-10-11(9-16)15-7-4-6-14-10/h10-11,14-15H,4-9H2,1-3H3/t10-,11+/m0/s1 |
| InChiKey: | InChIKey=OIWLFHQLCMDHRJ-WDEREUQCSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.