* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | WUXIAPPTEC WX115083-001 |
| EnglishSynonyms: | WUXIAPPTEC WX115083-001 ; WUXIAPPTEC WX115083-010 ; WUXIAPPTEC WX115083-005 |
| pro_mdlNumber: | MFCD17016575 |
| pro_acceptors: | 4 |
| pro_donors: | 1 |
| pro_smile: | CC(C)(C)OC(=O)N1CCC2(CNCCC2C1)C1=CC=CC=C1 |
| InChi: | InChI=1S/C19H28N2O2/c1-18(2,3)23-17(22)21-12-10-19(15-7-5-4-6-8-15)14-20-11-9-16(19)13-21/h4-8,16,20H,9-14H2,1-3H3 |
| InChiKey: | InChIKey=BBFXXHSDENGSRX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.