* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | WUXIAPPTEC WX115088-001 |
| EnglishSynonyms: | WUXIAPPTEC WX115088-001 ; WUXIAPPTEC WX115088-005 ; WUXIAPPTEC WX115088-010 |
| pro_mdlNumber: | MFCD17016578 |
| pro_acceptors: | 7 |
| pro_donors: | 1 |
| pro_smile: | CC(C)(C)OC(=O)N1C[C@@H]2NS(=O)(=O)C3=CC=CC=C3O[C@H]2C1 |
| InChi: | InChI=1S/C15H20N2O5S/c1-15(2,3)22-14(18)17-8-10-12(9-17)21-11-6-4-5-7-13(11)23(19,20)16-10/h4-7,10,12,16H,8-9H2,1-3H3/t10-,12-/m0/s1 |
| InChiKey: | InChIKey=KLQBYJQXOTWOIW-JQWIXIFHSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.