* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | WUXIAPPTEC WX115094-001 |
| EnglishSynonyms: | WUXIAPPTEC WX115094-005 ; WUXIAPPTEC WX115094-001 ; WUXIAPPTEC WX115094-010 |
| pro_mdlNumber: | MFCD17016580 |
| pro_acceptors: | 8 |
| pro_donors: | 1 |
| pro_smile: | CC(C)(C)OC(=O)N1CC[C@@H]2OC(C(O)=O)C3=CN=CN3[C@H]2CC1 |
| InChi: | InChI=1S/C16H23N3O5/c1-16(2,3)24-15(22)18-6-4-10-12(5-7-18)23-13(14(20)21)11-8-17-9-19(10)11/h8-10,12-13H,4-7H2,1-3H3,(H,20,21)/t10-,12-,13?/m0/s1 |
| InChiKey: | InChIKey=QIZSDNXOAVHWPK-QDYONFDCSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.