* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | WUXIAPPTEC WX115099-001 |
| EnglishSynonyms: | WUXIAPPTEC WX115099-010 ; WUXIAPPTEC WX115099-001 ; WUXIAPPTEC WX115099-005 |
| pro_mdlNumber: | MFCD17016585 |
| pro_acceptors: | 6 |
| pro_donors: | 1 |
| pro_smile: | CC(C)(C)OC(=O)N1CCC2COC(=O)C3CNCC23C1 |
| InChi: | InChI=1S/C15H24N2O4/c1-14(2,3)21-13(19)17-5-4-10-7-20-12(18)11-6-16-8-15(10,11)9-17/h10-11,16H,4-9H2,1-3H3 |
| InChiKey: | InChIKey=DYJZKLMODYKLJF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.