* If the product has intellectual property rights, a license granted is must or contact us.
basic_info |
|
Product_Name: | WUXIAPPTEC WX115100-001 |
EnglishSynonyms: | WUXIAPPTEC WX115100-005 ; WUXIAPPTEC WX115100-010 ; WUXIAPPTEC WX115100-001 |
pro_mdlNumber: | MFCD17016586 |
pro_acceptors: | 6 |
pro_donors: | 2 |
pro_smile: | O=C(OCC1=CC=CC=C1)N1CCC23CNCC2CNC(=O)C3C1 |
InChi: | InChI=1S/C18H23N3O3/c22-16-15-10-21(17(23)24-11-13-4-2-1-3-5-13)7-6-18(15)12-19-8-14(18)9-20-16/h1-5,14-15,19H,6-12H2,(H,20,22) |
InChiKey: | InChIKey=VJOUFLYVMROZIS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.