* If the product has intellectual property rights, a license granted is must or contact us.
basic_info |
|
Product_Name: | WUXIAPPTEC WX115121-001 |
EnglishSynonyms: | WUXIAPPTEC WX115121-010 ; WUXIAPPTEC WX115121-001 ; WUXIAPPTEC WX115121-005 |
pro_mdlNumber: | MFCD17016605 |
pro_acceptors: | 5 |
pro_donors: | 1 |
pro_smile: | CC(C)(C)OC(=O)N1CC2CCC3=C(SC(N)=N3)C2C1 |
InChi: | InChI=1S/C14H21N3O2S/c1-14(2,3)19-13(18)17-6-8-4-5-10-11(9(8)7-17)20-12(15)16-10/h8-9H,4-7H2,1-3H3,(H2,15,16) |
InChiKey: | InChIKey=QHJWQUQPTYEYFU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.