* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | WUXIAPPTEC WX115175-001 |
| EnglishSynonyms: | WUXIAPPTEC WX115175-005 ; WUXIAPPTEC WX115175-010 ; WUXIAPPTEC WX115175-001 |
| pro_mdlNumber: | MFCD17016646 |
| pro_acceptors: | 6 |
| pro_donors: | 1 |
| pro_smile: | CC(C)(C)OC(=O)N1C[C@@H]2OCCNC[C@@]2(C1)C1=NC=CS1 |
| InChi: | InChI=1S/C15H23N3O3S/c1-14(2,3)21-13(19)18-8-11-15(10-18,9-16-4-6-20-11)12-17-5-7-22-12/h5,7,11,16H,4,6,8-10H2,1-3H3/t11-,15-/m0/s1 |
| InChiKey: | InChIKey=RJGVOLZCJDNYRK-NHYWBVRUSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.